C10H12N4O2S3 — CID 106270396
5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophene-2-carbothioamide (PubChem CID 106270396) has the molecular formula C10H12N4O2S3 and a molecular weight of 316.43 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106270396 |
| Molecular Formula | C10H12N4O2S3 |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 5-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfamoyl]thiophene-2-carbothioamide |
| SMILES | Cc1n[nH]c(C)c1NS(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C10H12N4O2S3/c1-5-9(6(2)13-12-5)14-19(15,16)8-4-3-7(18-8)10(11)17/h3-4,14H,1-2H3,(H2,11,17)(H,12,13) |
| InChIKey | XZLAHDHKVYKVJB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|