C10H9N3O2S3 — CID 106269900
5-(pyridin-2-ylsulfamoyl)thiophene-2-carbothioamide (PubChem CID 106269900) has the molecular formula C10H9N3O2S3 and a molecular weight of 299.40 g/mol. Its IUPAC name is 5-(pyridin-2-ylsulfamoyl)thiophene-2-carbothioamide.
| Compound Name | 5-(pyridin-2-ylsulfamoyl)thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106269900 |
| Molecular Formula | C10H9N3O2S3 |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 5-(pyridin-2-ylsulfamoyl)thiophene-2-carbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)Nc2ccccn2)s1 |
| InChI | InChI=1S/C10H9N3O2S3/c11-10(16)7-4-5-9(17-7)18(14,15)13-8-3-1-2-6-12-8/h1-6H,(H2,11,16)(H,12,13) |
| InChIKey | JLKJCANKQNLLBH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|