C11H7BrF2N2O2S3 — CID 106271389
5-[(4-bromo-2,6-difluorophenyl)sulfamoyl]thiophene-2-carbothioamide (PubChem CID 106271389) has the molecular formula C11H7BrF2N2O2S3 and a molecular weight of 413.29 g/mol. Its IUPAC name is 5-[(4-bromo-2,6-difluorophenyl)sulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[(4-bromo-2,6-difluorophenyl)sulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106271389 |
| Molecular Formula | C11H7BrF2N2O2S3 |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 411.88 |
| IUPAC Name | 5-[(4-bromo-2,6-difluorophenyl)sulfamoyl]thiophene-2-carbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)Nc2c(F)cc(Br)cc2F)s1 |
| InChI | InChI=1S/C11H7BrF2N2O2S3/c12-5-3-6(13)10(7(14)4-5)16-21(17,18)9-2-1-8(20-9)11(15)19/h1-4,16H,(H2,15,19) |
| InChIKey | WRRHEOBPQOEIKW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|