C11H11FN4O4S — CID 81307188
N-(2-fluoro-6-nitrophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 81307188) has the molecular formula C11H11FN4O4S and a molecular weight of 314.30 g/mol. Its IUPAC name is N-(2-fluoro-6-nitrophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(2-fluoro-6-nitrophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 81307188 |
| Molecular Formula | C11H11FN4O4S |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | N-(2-fluoro-6-nitrophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)Nc1c(F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11FN4O4S/c1-6-11(7(2)14-13-6)21(19,20)15-10-8(12)4-3-5-9(10)16(17)18/h3-5,15H,1-2H3,(H,13,14) |
| InChIKey | FMELWLPLWDYBRB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|