C18H16IN5O2 — CID 4298093
2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 4298093) has the molecular formula C18H16IN5O2 and a molecular weight of 461.26 g/mol. Its IUPAC name is 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 4298093 |
| Molecular Formula | C18H16IN5O2 |
| Molecular Weight | 461.26 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | Cc1nc(Nc2ccc(I)cc2)nc(N(C)c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16IN5O2/c1-12-16(24(25)26)17(23(2)15-6-4-3-5-7-15)22-18(20-12)21-14-10-8-13(19)9-11-14/h3-11H,1-2H3,(H,20,21,22) |
| InChIKey | CXGGLKMJGSJSEH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.26 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|