About 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine
2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 4298093) has the molecular formula C18H16IN5O2
and a molecular weight of 461.26 g/mol. Its IUPAC name is 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine |
| PubChem CID | 4298093 |
| Molecular Formula | C18H16IN5O2 |
| Molecular Weight | 461.26 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | Cc1nc(Nc2ccc(I)cc2)nc(N(C)c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16IN5O2/c1-12-16(24(25)26)17(23(2)15-6-4-3-5-7-15)22-18(20-12)21-14-10-8-13(19)9-11-14/h3-11H,1-2H3,(H,20,21,22) |
| InChIKey | CXGGLKMJGSJSEH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.26 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine?
The IUPAC name of 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine (CID 4298093) is 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine.
What is the SMILES notation for 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine?
The canonical SMILES for 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine is Cc1nc(Nc2ccc(I)cc2)nc(N(C)c2ccccc2)c1[N+](=O)[O-].
What is the InChIKey of 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine?
The InChIKey is CXGGLKMJGSJSEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16IN5O2/c1-12-16(24(25)26)17(23(2)15-6-4-3-5-7-15)22-18(20-12)21-14-10-8-13(19)9-11-14/h3-11H,1-2H3,(H,20,21,22).
What are the key properties of 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine?
2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine has a molecular weight of 461.26 g/mol, XLogP of 4.81, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(4-iodophenyl)-4-N,6-dimethyl-5-nitro-4-N-phenylpyrimidine-2,4-diamine is sourced from PubChem (CID 4298093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).