About [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate
[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate (PubChem CID 9147891) has the molecular formula C21H20N4O4
and a molecular weight of 392.42 g/mol. Its IUPAC name is [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate.
Molecular Properties
| Compound Name | [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate |
| PubChem CID | 9147891 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate |
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(C(=O)Oc2cccc(Nc3nc(C)cc(C)n3)c2)c1 |
| InChI | InChI=1S/C21H20N4O4/c1-12-8-13(2)19(25(27)28)18(9-12)20(26)29-17-7-5-6-16(11-17)24-21-22-14(3)10-15(4)23-21/h5-11H,1-4H3,(H,22,23,24) |
| InChIKey | VTNDUYYUCONJLU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate?
The IUPAC name of [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate (CID 9147891) is [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate.
What is the SMILES notation for [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate?
The canonical SMILES for [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate is Cc1cc(C)c([N+](=O)[O-])c(C(=O)Oc2cccc(Nc3nc(C)cc(C)n3)c2)c1.
What is the InChIKey of [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate?
The InChIKey is VTNDUYYUCONJLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O4/c1-12-8-13(2)19(25(27)28)18(9-12)20(26)29-17-7-5-6-16(11-17)24-21-22-14(3)10-15(4)23-21/h5-11H,1-4H3,(H,22,23,24).
What are the key properties of [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate?
[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate has a molecular weight of 392.42 g/mol, XLogP of 4.58, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 3,5-dimethyl-2-nitrobenzoate is sourced from PubChem (CID 9147891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).