About [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate
[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate (PubChem CID 9148718) has the molecular formula C21H21N3O3
and a molecular weight of 363.42 g/mol. Its IUPAC name is [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate.
Molecular Properties
| Compound Name | [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate |
| PubChem CID | 9148718 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate |
| SMILES | Cc1cccc(OCC(=O)Oc2ccc(Nc3nc(C)cc(C)n3)cc2)c1 |
| InChI | InChI=1S/C21H21N3O3/c1-14-5-4-6-19(11-14)26-13-20(25)27-18-9-7-17(8-10-18)24-21-22-15(2)12-16(3)23-21/h4-12H,13H2,1-3H3,(H,22,23,24) |
| InChIKey | DKRONRSBHVXPCE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate?
The IUPAC name of [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate (CID 9148718) is [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate.
What is the SMILES notation for [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate?
The canonical SMILES for [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate is Cc1cccc(OCC(=O)Oc2ccc(Nc3nc(C)cc(C)n3)cc2)c1.
What is the InChIKey of [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate?
The InChIKey is DKRONRSBHVXPCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O3/c1-14-5-4-6-19(11-14)26-13-20(25)27-18-9-7-17(8-10-18)24-21-22-15(2)12-16(3)23-21/h4-12H,13H2,1-3H3,(H,22,23,24).
What are the key properties of [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate?
[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate has a molecular weight of 363.42 g/mol, XLogP of 4.13, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-(3-methylphenoxy)acetate is sourced from PubChem (CID 9148718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).