C19H21NO4 — CID 18870324
(3,5-dimethylphenyl) 2-[3-(propanoylamino)phenoxy]acetate (PubChem CID 18870324) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (3,5-dimethylphenyl) 2-[3-(propanoylamino)phenoxy]acetate.
| Compound Name | (3,5-dimethylphenyl) 2-[3-(propanoylamino)phenoxy]acetate |
|---|---|
| PubChem CID | 18870324 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (3,5-dimethylphenyl) 2-[3-(propanoylamino)phenoxy]acetate |
| SMILES | CCC(=O)Nc1cccc(OCC(=O)Oc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C19H21NO4/c1-4-18(21)20-15-6-5-7-16(11-15)23-12-19(22)24-17-9-13(2)8-14(3)10-17/h5-11H,4,12H2,1-3H3,(H,20,21) |
| InChIKey | HSEZFIGNOFCJTQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|