C21H25NO4 — CID 18870412
(3,5-dimethylphenyl) 2-[3-(2,2-dimethylpropanoylamino)phenoxy]acetate (PubChem CID 18870412) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is (3,5-dimethylphenyl) 2-[3-(2,2-dimethylpropanoylamino)phenoxy]acetate.
| Compound Name | (3,5-dimethylphenyl) 2-[3-(2,2-dimethylpropanoylamino)phenoxy]acetate |
|---|---|
| PubChem CID | 18870412 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (3,5-dimethylphenyl) 2-[3-(2,2-dimethylpropanoylamino)phenoxy]acetate |
| SMILES | Cc1cc(C)cc(OC(=O)COc2cccc(NC(=O)C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C21H25NO4/c1-14-9-15(2)11-18(10-14)26-19(23)13-25-17-8-6-7-16(12-17)22-20(24)21(3,4)5/h6-12H,13H2,1-5H3,(H,22,24) |
| InChIKey | JTBKQBUNANMNNF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|