C19H20BrNO4 — CID 18870358
(4-bromophenyl) 2-[3-(2,2-dimethylpropanoylamino)phenoxy]acetate (PubChem CID 18870358) has the molecular formula C19H20BrNO4 and a molecular weight of 406.28 g/mol. Its IUPAC name is (4-bromophenyl) 2-[3-(2,2-dimethylpropanoylamino)phenoxy]acetate.
| Compound Name | (4-bromophenyl) 2-[3-(2,2-dimethylpropanoylamino)phenoxy]acetate |
|---|---|
| PubChem CID | 18870358 |
| Molecular Formula | C19H20BrNO4 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (4-bromophenyl) 2-[3-(2,2-dimethylpropanoylamino)phenoxy]acetate |
| SMILES | CC(C)(C)C(=O)Nc1cccc(OCC(=O)Oc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C19H20BrNO4/c1-19(2,3)18(23)21-14-5-4-6-16(11-14)24-12-17(22)25-15-9-7-13(20)8-10-15/h4-11H,12H2,1-3H3,(H,21,23) |
| InChIKey | HOWHRYBGJCCRTR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|