C20H22N2O5 — CID 18870384
4-[[2-[3-(2,2-dimethylpropanoylamino)phenoxy]acetyl]amino]benzoic acid (PubChem CID 18870384) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-[[2-[3-(2,2-dimethylpropanoylamino)phenoxy]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[3-(2,2-dimethylpropanoylamino)phenoxy]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18870384 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 4-[[2-[3-(2,2-dimethylpropanoylamino)phenoxy]acetyl]amino]benzoic acid |
| SMILES | CC(C)(C)C(=O)Nc1cccc(OCC(=O)Nc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C20H22N2O5/c1-20(2,3)19(26)22-15-5-4-6-16(11-15)27-12-17(23)21-14-9-7-13(8-10-14)18(24)25/h4-11H,12H2,1-3H3,(H,21,23)(H,22,26)(H,24,25) |
| InChIKey | MQFMBHKPIUKYRJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |