C19H21NO4 — CID 17342012
[3-[[2-(3,4-dimethylphenoxy)acetyl]amino]phenyl] propanoate (PubChem CID 17342012) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is [3-[[2-(3,4-dimethylphenoxy)acetyl]amino]phenyl] propanoate.
| Compound Name | [3-[[2-(3,4-dimethylphenoxy)acetyl]amino]phenyl] propanoate |
|---|---|
| PubChem CID | 17342012 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | [3-[[2-(3,4-dimethylphenoxy)acetyl]amino]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(NC(=O)COc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C19H21NO4/c1-4-19(22)24-17-7-5-6-15(11-17)20-18(21)12-23-16-9-8-13(2)14(3)10-16/h5-11H,4,12H2,1-3H3,(H,20,21) |
| InChIKey | RYGHTFGYCIXAKW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|