C15H17N2O2+ — CID 3658963
2-(3,4-dimethylphenoxy)-N-pyridin-1-ium-3-ylacetamide (PubChem CID 3658963) has the molecular formula C15H17N2O2+ and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N-pyridin-1-ium-3-ylacetamide.
| Compound Name | 2-(3,4-dimethylphenoxy)-N-pyridin-1-ium-3-ylacetamide |
|---|---|
| PubChem CID | 3658963 |
| Molecular Formula | C15H17N2O2+ |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N-pyridin-1-ium-3-ylacetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2ccc[nH+]c2)cc1C |
| InChI | InChI=1S/C15H16N2O2/c1-11-5-6-14(8-12(11)2)19-10-15(18)17-13-4-3-7-16-9-13/h3-9H,10H2,1-2H3,(H,17,18)/p+1 |
| InChIKey | MGVZZEPOMGDYCH-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |