C22H21NO2S — CID 1121779
2-(3,4-dimethylphenoxy)-N-(4-phenylsulfanylphenyl)acetamide (PubChem CID 1121779) has the molecular formula C22H21NO2S and a molecular weight of 363.48 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N-(4-phenylsulfanylphenyl)acetamide.
| Compound Name | 2-(3,4-dimethylphenoxy)-N-(4-phenylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 1121779 |
| Molecular Formula | C22H21NO2S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N-(4-phenylsulfanylphenyl)acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2ccc(Sc3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C22H21NO2S/c1-16-8-11-19(14-17(16)2)25-15-22(24)23-18-9-12-21(13-10-18)26-20-6-4-3-5-7-20/h3-14H,15H2,1-2H3,(H,23,24) |
| InChIKey | RSKNRSIOVLBOOH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |