C20H25NO3 — CID 17160586
N-(4-butan-2-yloxyphenyl)-2-(3,4-dimethylphenoxy)acetamide (PubChem CID 17160586) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is N-(4-butan-2-yloxyphenyl)-2-(3,4-dimethylphenoxy)acetamide.
| Compound Name | N-(4-butan-2-yloxyphenyl)-2-(3,4-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 17160586 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-(4-butan-2-yloxyphenyl)-2-(3,4-dimethylphenoxy)acetamide |
| SMILES | CCC(C)Oc1ccc(NC(=O)COc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C20H25NO3/c1-5-16(4)24-18-10-7-17(8-11-18)21-20(22)13-23-19-9-6-14(2)15(3)12-19/h6-12,16H,5,13H2,1-4H3,(H,21,22) |
| InChIKey | HFUZDXNZCKVCHQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |