C19H16FN3O2 — CID 9147872
[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-fluorobenzoate (PubChem CID 9147872) has the molecular formula C19H16FN3O2 and a molecular weight of 337.35 g/mol. Its IUPAC name is [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-fluorobenzoate.
| Compound Name | [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 9147872 |
| Molecular Formula | C19H16FN3O2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | [3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl] 2-fluorobenzoate |
| SMILES | Cc1cc(C)nc(Nc2cccc(OC(=O)c3ccccc3F)c2)n1 |
| InChI | InChI=1S/C19H16FN3O2/c1-12-10-13(2)22-19(21-12)23-14-6-5-7-15(11-14)25-18(24)16-8-3-4-9-17(16)20/h3-11H,1-2H3,(H,21,22,23) |
| InChIKey | FUGCMVMBHYOQQQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|