C19H16ClN3O2S — CID 9148886
[3-[(6-methyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl] 2-chlorobenzoate (PubChem CID 9148886) has the molecular formula C19H16ClN3O2S and a molecular weight of 385.88 g/mol. Its IUPAC name is [3-[(6-methyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl] 2-chlorobenzoate.
| Compound Name | [3-[(6-methyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 9148886 |
| Molecular Formula | C19H16ClN3O2S |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | [3-[(6-methyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl] 2-chlorobenzoate |
| SMILES | CSc1nc(C)cc(Nc2cccc(OC(=O)c3ccccc3Cl)c2)n1 |
| InChI | InChI=1S/C19H16ClN3O2S/c1-12-10-17(23-19(21-12)26-2)22-13-6-5-7-14(11-13)25-18(24)15-8-3-4-9-16(15)20/h3-11H,1-2H3,(H,21,22,23) |
| InChIKey | CTVQDNXKZNWYLQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|