C21H21N3O4S — CID 9148937
[3-[(6-methyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl] 3,4-dimethoxybenzoate (PubChem CID 9148937) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is [3-[(6-methyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [3-[(6-methyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 9148937 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [3-[(6-methyl-2-methylsulfanylpyrimidin-4-yl)amino]phenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2cccc(Nc3cc(C)nc(SC)n3)c2)cc1OC |
| InChI | InChI=1S/C21H21N3O4S/c1-13-10-19(24-21(22-13)29-4)23-15-6-5-7-16(12-15)28-20(25)14-8-9-17(26-2)18(11-14)27-3/h5-12H,1-4H3,(H,22,23,24) |
| InChIKey | LYKBSRHMNSBGKE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|