C12H12ClN3S2 — CID 80544469
6-chloro-2-methylsulfanyl-N-(3-methylsulfanylphenyl)pyrimidin-4-amine (PubChem CID 80544469) has the molecular formula C12H12ClN3S2 and a molecular weight of 297.84 g/mol. Its IUPAC name is 6-chloro-2-methylsulfanyl-N-(3-methylsulfanylphenyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-methylsulfanyl-N-(3-methylsulfanylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80544469 |
| Molecular Formula | C12H12ClN3S2 |
| Molecular Weight | 297.84 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 6-chloro-2-methylsulfanyl-N-(3-methylsulfanylphenyl)pyrimidin-4-amine |
| SMILES | CSc1cccc(Nc2cc(Cl)nc(SC)n2)c1 |
| InChI | InChI=1S/C12H12ClN3S2/c1-17-9-5-3-4-8(6-9)14-11-7-10(13)15-12(16-11)18-2/h3-7H,1-2H3,(H,14,15,16) |
| InChIKey | JOUYRHBSVPGZCQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.84 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |