C11H9ClIN3S — CID 80544731
6-chloro-N-(2-iodophenyl)-2-methylsulfanylpyrimidin-4-amine (PubChem CID 80544731) has the molecular formula C11H9ClIN3S and a molecular weight of 377.64 g/mol. Its IUPAC name is 6-chloro-N-(2-iodophenyl)-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(2-iodophenyl)-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80544731 |
| Molecular Formula | C11H9ClIN3S |
| Molecular Weight | 377.64 g/mol |
| Exact Mass | 376.93 |
| IUPAC Name | 6-chloro-N-(2-iodophenyl)-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1nc(Cl)cc(Nc2ccccc2I)n1 |
| InChI | InChI=1S/C11H9ClIN3S/c1-17-11-15-9(12)6-10(16-11)14-8-5-3-2-4-7(8)13/h2-6H,1H3,(H,14,15,16) |
| InChIKey | BUVJYYFZUUJLRF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|