C12H11BrClN3S — CID 80544730
N-(4-bromo-3-methylphenyl)-6-chloro-2-methylsulfanylpyrimidin-4-amine (PubChem CID 80544730) has the molecular formula C12H11BrClN3S and a molecular weight of 344.67 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-6-chloro-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | N-(4-bromo-3-methylphenyl)-6-chloro-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80544730 |
| Molecular Formula | C12H11BrClN3S |
| Molecular Weight | 344.67 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-6-chloro-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1nc(Cl)cc(Nc2ccc(Br)c(C)c2)n1 |
| InChI | InChI=1S/C12H11BrClN3S/c1-7-5-8(3-4-9(7)13)15-11-6-10(14)16-12(17-11)18-2/h3-6H,1-2H3,(H,15,16,17) |
| InChIKey | AUNSSBZWWIMSSP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.67 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |