C12H12ClN3S — CID 14935475
N-(4-chlorophenyl)-6-methyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 14935475) has the molecular formula C12H12ClN3S and a molecular weight of 265.77 g/mol. Its IUPAC name is N-(4-chlorophenyl)-6-methyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | N-(4-chlorophenyl)-6-methyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 14935475 |
| Molecular Formula | C12H12ClN3S |
| Molecular Weight | 265.77 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | N-(4-chlorophenyl)-6-methyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1nc(C)cc(Nc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C12H12ClN3S/c1-8-7-11(16-12(14-8)17-2)15-10-5-3-9(13)4-6-10/h3-7H,1-2H3,(H,14,15,16) |
| InChIKey | SKACJVVRKDDLLJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.77 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |