C13H13ClN4OS — CID 88571946
3-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]-N-methylbenzamide (PubChem CID 88571946) has the molecular formula C13H13ClN4OS and a molecular weight of 308.79 g/mol. Its IUPAC name is 3-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]-N-methylbenzamide.
| Compound Name | 3-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 88571946 |
| Molecular Formula | C13H13ClN4OS |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 3-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(Nc2cc(Cl)nc(SC)n2)c1 |
| InChI | InChI=1S/C13H13ClN4OS/c1-15-12(19)8-4-3-5-9(6-8)16-11-7-10(14)17-13(18-11)20-2/h3-7H,1-2H3,(H,15,19)(H,16,17,18) |
| InChIKey | GQPDVBIBMBNTAQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |