C16H17N5O2S — CID 121286177
4-ethenyl-6-[3-(methylcarbamoyl)anilino]-2-methylsulfanylpyrimidine-5-carboxamide (PubChem CID 121286177) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-ethenyl-6-[3-(methylcarbamoyl)anilino]-2-methylsulfanylpyrimidine-5-carboxamide.
| Compound Name | 4-ethenyl-6-[3-(methylcarbamoyl)anilino]-2-methylsulfanylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121286177 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 4-ethenyl-6-[3-(methylcarbamoyl)anilino]-2-methylsulfanylpyrimidine-5-carboxamide |
| SMILES | C=Cc1nc(SC)nc(Nc2cccc(C(=O)NC)c2)c1C(N)=O |
| InChI | InChI=1S/C16H17N5O2S/c1-4-11-12(13(17)22)14(21-16(20-11)24-3)19-10-7-5-6-9(8-10)15(23)18-2/h4-8H,1H2,2-3H3,(H2,17,22)(H,18,23)(H,19,20,21) |
| InChIKey | FYPOUCAQNBVFSZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |