C11H14N2O4 — CID 79346068
2-hydroxyethyl N-[3-(methylcarbamoyl)phenyl]carbamate (PubChem CID 79346068) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-hydroxyethyl N-[3-(methylcarbamoyl)phenyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[3-(methylcarbamoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 79346068 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-hydroxyethyl N-[3-(methylcarbamoyl)phenyl]carbamate |
| SMILES | CNC(=O)c1cccc(NC(=O)OCCO)c1 |
| InChI | InChI=1S/C11H14N2O4/c1-12-10(15)8-3-2-4-9(7-8)13-11(16)17-6-5-14/h2-4,7,14H,5-6H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | KSVDJHGKXVBKJD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |