C13H19NO4 — CID 79346235
2-hydroxyethyl N-[3-(2-methylpropoxy)phenyl]carbamate (PubChem CID 79346235) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-hydroxyethyl N-[3-(2-methylpropoxy)phenyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[3-(2-methylpropoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 79346235 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-hydroxyethyl N-[3-(2-methylpropoxy)phenyl]carbamate |
| SMILES | CC(C)COc1cccc(NC(=O)OCCO)c1 |
| InChI | InChI=1S/C13H19NO4/c1-10(2)9-18-12-5-3-4-11(8-12)14-13(16)17-7-6-15/h3-5,8,10,15H,6-7,9H2,1-2H3,(H,14,16) |
| InChIKey | AHHZEBWEGXBGOU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |