C21H28N2O3 — CID 17170442
1,3-bis[3-(2-methylpropoxy)phenyl]urea (PubChem CID 17170442) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1,3-bis[3-(2-methylpropoxy)phenyl]urea.
| Compound Name | 1,3-bis[3-(2-methylpropoxy)phenyl]urea |
|---|---|
| PubChem CID | 17170442 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1,3-bis[3-(2-methylpropoxy)phenyl]urea |
| SMILES | CC(C)COc1cccc(NC(=O)Nc2cccc(OCC(C)C)c2)c1 |
| InChI | InChI=1S/C21H28N2O3/c1-15(2)13-25-19-9-5-7-17(11-19)22-21(24)23-18-8-6-10-20(12-18)26-14-16(3)4/h5-12,15-16H,13-14H2,1-4H3,(H2,22,23,24) |
| InChIKey | ITAOWDGOGJLSPA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |