C12H13N3S — CID 80647295
6-N-(3-methylsulfanylphenyl)pyridine-2,6-diamine (PubChem CID 80647295) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 6-N-(3-methylsulfanylphenyl)pyridine-2,6-diamine.
| Compound Name | 6-N-(3-methylsulfanylphenyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80647295 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 6-N-(3-methylsulfanylphenyl)pyridine-2,6-diamine |
| SMILES | CSc1cccc(Nc2cccc(N)n2)c1 |
| InChI | InChI=1S/C12H13N3S/c1-16-10-5-2-4-9(8-10)14-12-7-3-6-11(13)15-12/h2-8H,1H3,(H3,13,14,15) |
| InChIKey | XEVKKPJMZIGGDT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |