C13H15N3S — CID 79020854
6-methyl-2-N-(3-methylsulfanylphenyl)pyridine-2,3-diamine (PubChem CID 79020854) has the molecular formula C13H15N3S and a molecular weight of 245.35 g/mol. Its IUPAC name is 6-methyl-2-N-(3-methylsulfanylphenyl)pyridine-2,3-diamine.
| Compound Name | 6-methyl-2-N-(3-methylsulfanylphenyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 79020854 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 6-methyl-2-N-(3-methylsulfanylphenyl)pyridine-2,3-diamine |
| SMILES | CSc1cccc(Nc2nc(C)ccc2N)c1 |
| InChI | InChI=1S/C13H15N3S/c1-9-6-7-12(14)13(15-9)16-10-4-3-5-11(8-10)17-2/h3-8H,14H2,1-2H3,(H,15,16) |
| InChIKey | OZVKOQBZHNNUJA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |