C13H12F2N2S — CID 62531616
3,4-difluoro-2-N-(3-methylsulfanylphenyl)benzene-1,2-diamine (PubChem CID 62531616) has the molecular formula C13H12F2N2S and a molecular weight of 266.32 g/mol. Its IUPAC name is 3,4-difluoro-2-N-(3-methylsulfanylphenyl)benzene-1,2-diamine.
| Compound Name | 3,4-difluoro-2-N-(3-methylsulfanylphenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 62531616 |
| Molecular Formula | C13H12F2N2S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3,4-difluoro-2-N-(3-methylsulfanylphenyl)benzene-1,2-diamine |
| SMILES | CSc1cccc(Nc2c(N)ccc(F)c2F)c1 |
| InChI | InChI=1S/C13H12F2N2S/c1-18-9-4-2-3-8(7-9)17-13-11(16)6-5-10(14)12(13)15/h2-7,17H,16H2,1H3 |
| InChIKey | YEBPKTPXJWXRGE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|