C16H15N3S — CID 43809585
6-N-(3-methylsulfanylphenyl)quinoline-5,6-diamine (PubChem CID 43809585) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 6-N-(3-methylsulfanylphenyl)quinoline-5,6-diamine.
| Compound Name | 6-N-(3-methylsulfanylphenyl)quinoline-5,6-diamine |
|---|---|
| PubChem CID | 43809585 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 6-N-(3-methylsulfanylphenyl)quinoline-5,6-diamine |
| SMILES | CSc1cccc(Nc2ccc3ncccc3c2N)c1 |
| InChI | InChI=1S/C16H15N3S/c1-20-12-5-2-4-11(10-12)19-15-8-7-14-13(16(15)17)6-3-9-18-14/h2-10,19H,17H2,1H3 |
| InChIKey | GQKHZGJGCFTNIX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|