C12H13N3O2S2 — CID 53151377
2-(3-methylsulfanylanilino)pyridine-3-sulfonamide (PubChem CID 53151377) has the molecular formula C12H13N3O2S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 2-(3-methylsulfanylanilino)pyridine-3-sulfonamide.
| Compound Name | 2-(3-methylsulfanylanilino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 53151377 |
| Molecular Formula | C12H13N3O2S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-(3-methylsulfanylanilino)pyridine-3-sulfonamide |
| SMILES | CSc1cccc(Nc2ncccc2S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H13N3O2S2/c1-18-10-5-2-4-9(8-10)15-12-11(19(13,16)17)6-3-7-14-12/h2-8H,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | ZQYHRWKDHBOXLL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |