C12H13N3O4S2 — CID 53151392
2-(4-methylsulfonylanilino)pyridine-3-sulfonamide (PubChem CID 53151392) has the molecular formula C12H13N3O4S2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-(4-methylsulfonylanilino)pyridine-3-sulfonamide.
| Compound Name | 2-(4-methylsulfonylanilino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 53151392 |
| Molecular Formula | C12H13N3O4S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 2-(4-methylsulfonylanilino)pyridine-3-sulfonamide |
| SMILES | CS(=O)(=O)c1ccc(Nc2ncccc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H13N3O4S2/c1-20(16,17)10-6-4-9(5-7-10)15-12-11(21(13,18)19)3-2-8-14-12/h2-8H,1H3,(H,14,15)(H2,13,18,19) |
| InChIKey | QWYWROXCVMYIPG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |