C12H12N2O5S2 — CID 115928497
2-(4-methylsulfonylphenoxy)pyridine-3-sulfonamide (PubChem CID 115928497) has the molecular formula C12H12N2O5S2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenoxy)pyridine-3-sulfonamide.
| Compound Name | 2-(4-methylsulfonylphenoxy)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115928497 |
| Molecular Formula | C12H12N2O5S2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 2-(4-methylsulfonylphenoxy)pyridine-3-sulfonamide |
| SMILES | CS(=O)(=O)c1ccc(Oc2ncccc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H12N2O5S2/c1-20(15,16)10-6-4-9(5-7-10)19-12-11(21(13,17)18)3-2-8-14-12/h2-8H,1H3,(H2,13,17,18) |
| InChIKey | YFKPBAYCDDMXDL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |