C13H14N2O3S — CID 112572887
2-(2,5-dimethylphenoxy)pyridine-3-sulfonamide (PubChem CID 112572887) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)pyridine-3-sulfonamide.
| Compound Name | 2-(2,5-dimethylphenoxy)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 112572887 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)pyridine-3-sulfonamide |
| SMILES | Cc1ccc(C)c(Oc2ncccc2S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H14N2O3S/c1-9-5-6-10(2)11(8-9)18-13-12(19(14,16)17)4-3-7-15-13/h3-8H,1-2H3,(H2,14,16,17) |
| InChIKey | FSFZVKXBTSWOOX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |