C12H10FN3O4S — CID 115928496
2-fluoro-6-[(3-sulfamoyl-2-pyridinyl)oxy]benzamide (PubChem CID 115928496) has the molecular formula C12H10FN3O4S and a molecular weight of 311.29 g/mol. Its IUPAC name is 2-fluoro-6-[(3-sulfamoyl-2-pyridinyl)oxy]benzamide.
| Compound Name | 2-fluoro-6-[(3-sulfamoyl-2-pyridinyl)oxy]benzamide |
|---|---|
| PubChem CID | 115928496 |
| Molecular Formula | C12H10FN3O4S |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2-fluoro-6-[(3-sulfamoyl-2-pyridinyl)oxy]benzamide |
| SMILES | NC(=O)c1c(F)cccc1Oc1ncccc1S(N)(=O)=O |
| InChI | InChI=1S/C12H10FN3O4S/c13-7-3-1-4-8(10(7)11(14)17)20-12-9(21(15,18)19)5-2-6-16-12/h1-6H,(H2,14,17)(H2,15,18,19) |
| InChIKey | PXPPMCWXAPWQDG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |