C10H12N4O3S — CID 112573130
2-(2,5-dimethylpyrazol-3-yl)oxypyridine-3-sulfonamide (PubChem CID 112573130) has the molecular formula C10H12N4O3S and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrazol-3-yl)oxypyridine-3-sulfonamide.
| Compound Name | 2-(2,5-dimethylpyrazol-3-yl)oxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 112573130 |
| Molecular Formula | C10H12N4O3S |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-(2,5-dimethylpyrazol-3-yl)oxypyridine-3-sulfonamide |
| SMILES | Cc1cc(Oc2ncccc2S(N)(=O)=O)n(C)n1 |
| InChI | InChI=1S/C10H12N4O3S/c1-7-6-9(14(2)13-7)17-10-8(18(11,15)16)4-3-5-12-10/h3-6H,1-2H3,(H2,11,15,16) |
| InChIKey | JCUAJFLZFCYDIR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |