C11H11N3O3 — CID 81342189
2-(2,5-dimethylpyrazol-3-yl)oxypyridine-3-carboxylic acid (PubChem CID 81342189) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrazol-3-yl)oxypyridine-3-carboxylic acid.
| Compound Name | 2-(2,5-dimethylpyrazol-3-yl)oxypyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 81342189 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-(2,5-dimethylpyrazol-3-yl)oxypyridine-3-carboxylic acid |
| SMILES | Cc1cc(Oc2ncccc2C(=O)O)n(C)n1 |
| InChI | InChI=1S/C11H11N3O3/c1-7-6-9(14(2)13-7)17-10-8(11(15)16)4-3-5-12-10/h3-6H,1-2H3,(H,15,16) |
| InChIKey | AZVOOTPUSOLGIJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |