C11H12ClN5O2 — CID 136739765
3-chloro-2-(2,5-dimethylpyrazol-3-yl)oxy-N'-hydroxypyridine-4-carboximidamide (PubChem CID 136739765) has the molecular formula C11H12ClN5O2 and a molecular weight of 281.70 g/mol. Its IUPAC name is 3-chloro-2-(2,5-dimethylpyrazol-3-yl)oxy-N'-hydroxypyridine-4-carboximidamide.
| Compound Name | 3-chloro-2-(2,5-dimethylpyrazol-3-yl)oxy-N'-hydroxypyridine-4-carboximidamide |
|---|---|
| PubChem CID | 136739765 |
| Molecular Formula | C11H12ClN5O2 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 3-chloro-2-(2,5-dimethylpyrazol-3-yl)oxy-N'-hydroxypyridine-4-carboximidamide |
| SMILES | Cc1cc(Oc2nccc(/C(N)=N/O)c2Cl)n(C)n1 |
| InChI | InChI=1S/C11H12ClN5O2/c1-6-5-8(17(2)15-6)19-11-9(12)7(3-4-14-11)10(13)16-18/h3-5,18H,1-2H3,(H2,13,16) |
| InChIKey | LTICMCFBYNBKHG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|