C9H12ClN3O3 — CID 136739694
3-chloro-N'-hydroxy-2-(3-hydroxypropoxy)pyridine-4-carboximidamide (PubChem CID 136739694) has the molecular formula C9H12ClN3O3 and a molecular weight of 245.67 g/mol. Its IUPAC name is 3-chloro-N'-hydroxy-2-(3-hydroxypropoxy)pyridine-4-carboximidamide.
| Compound Name | 3-chloro-N'-hydroxy-2-(3-hydroxypropoxy)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 136739694 |
| Molecular Formula | C9H12ClN3O3 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 3-chloro-N'-hydroxy-2-(3-hydroxypropoxy)pyridine-4-carboximidamide |
| SMILES | N/C(=N/O)c1ccnc(OCCCO)c1Cl |
| InChI | InChI=1S/C9H12ClN3O3/c10-7-6(8(11)13-15)2-3-12-9(7)16-5-1-4-14/h2-3,14-15H,1,4-5H2,(H2,11,13) |
| InChIKey | LYINSYIAMMNRFJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|