About 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid
2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid (PubChem CID 71016995) has the molecular formula C11H12N4O2
and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid.
Analyze 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid?
The IUPAC name of 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid (CID 71016995) is 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid.
What is the SMILES notation for 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid?
The canonical SMILES for 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid is Cc1cc(Nc2ncccc2C(=O)O)n(C)n1.
What is the InChIKey of 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid?
The InChIKey is FAYLOUUNMQUMHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2/c1-7-6-9(15(2)14-7)13-10-8(11(16)17)4-3-5-12-10/h3-6H,1-2H3,(H,12,13)(H,16,17).
What are the key properties of 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid?
2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid has a molecular weight of 232.24 g/mol, XLogP of 1.57, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid is sourced from PubChem (CID 71016995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).