2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid

C11H12N4O2 — CID 71016995

IUPAC2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid
SMILESCc1cc(Nc2ncccc2C(=O)O)n(C)n1
InChIInChI=1S/C11H12N4O2/c1-7-6-9(15(2)14-7)13-10-8(11(16)17)4-3-5-12-10/h3-6H,1-2H3,(H,12,13)(H,16,17)
InChIKeyFAYLOUUNMQUMHY-UHFFFAOYSA-N
MW232.24 g/mol
LogP1.57
Rot. Bonds3

About 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid

2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid (PubChem CID 71016995) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid
PubChem CID71016995
Molecular FormulaC11H12N4O2
Molecular Weight232.24 g/mol
Exact Mass232.10
IUPAC Name2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid
SMILESCc1cc(Nc2ncccc2C(=O)O)n(C)n1
InChIInChI=1S/C11H12N4O2/c1-7-6-9(15(2)14-7)13-10-8(11(16)17)4-3-5-12-10/h3-6H,1-2H3,(H,12,13)(H,16,17)
InChIKeyFAYLOUUNMQUMHY-UHFFFAOYSA-N
XLogP1.57
TPSA80.04 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.24
LogP ≤ 51.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid?
The IUPAC name of 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid (CID 71016995) is 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid.
What is the SMILES notation for 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid?
The canonical SMILES for 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid is Cc1cc(Nc2ncccc2C(=O)O)n(C)n1.
What is the InChIKey of 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid?
The InChIKey is FAYLOUUNMQUMHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2/c1-7-6-9(15(2)14-7)13-10-8(11(16)17)4-3-5-12-10/h3-6H,1-2H3,(H,12,13)(H,16,17).
What are the key properties of 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid?
2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid has a molecular weight of 232.24 g/mol, XLogP of 1.57, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dimethylpyrazol-3-yl)amino]pyridine-3-carboxylic acid is sourced from PubChem (CID 71016995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).