2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid

C26H22Cl2N4O4 — CID 67783774

IUPAC2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid
SMILESCc1c(Cl)cccc1Nc1ncccc1C(=O)O.Cc1c(Cl)cccc1Nc1ncccc1C(=O)O
InChIInChI=1S/2C13H11ClN2O2/c2*1-8-10(14)5-2-6-11(8)16-12-9(13(17)18)4-3-7-15-12/h2*2-7H,1H3,(H,15,16)(H,17,18)
InChIKeyYRRNKTFHBHMPGZ-UHFFFAOYSA-N
MW525.39 g/mol
LogP6.97
Rot. Bonds6

About 2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid

2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid (PubChem CID 67783774) has the molecular formula C26H22Cl2N4O4 and a molecular weight of 525.39 g/mol. Its IUPAC name is 2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid
PubChem CID67783774
Molecular FormulaC26H22Cl2N4O4
Molecular Weight525.39 g/mol
Exact Mass524.10
IUPAC Name2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid
SMILESCc1c(Cl)cccc1Nc1ncccc1C(=O)O.Cc1c(Cl)cccc1Nc1ncccc1C(=O)O
InChIInChI=1S/2C13H11ClN2O2/c2*1-8-10(14)5-2-6-11(8)16-12-9(13(17)18)4-3-7-15-12/h2*2-7H,1H3,(H,15,16)(H,17,18)
InChIKeyYRRNKTFHBHMPGZ-UHFFFAOYSA-N
XLogP6.97
TPSA124.44 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms36
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500525.39
LogP ≤ 56.97
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Analyze 2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid?
The IUPAC name of 2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid (CID 67783774) is 2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid.
What is the SMILES notation for 2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid?
The canonical SMILES for 2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid is Cc1c(Cl)cccc1Nc1ncccc1C(=O)O.Cc1c(Cl)cccc1Nc1ncccc1C(=O)O.
What is the InChIKey of 2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid?
The InChIKey is YRRNKTFHBHMPGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H11ClN2O2/c2*1-8-10(14)5-2-6-11(8)16-12-9(13(17)18)4-3-7-15-12/h2*2-7H,1H3,(H,15,16)(H,17,18).
What are the key properties of 2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid?
2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid has a molecular weight of 525.39 g/mol, XLogP of 6.97, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid is sourced from PubChem (CID 67783774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).