C13H12ClN3O2 — CID 114046976
5-amino-2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid (PubChem CID 114046976) has the molecular formula C13H12ClN3O2 and a molecular weight of 277.71 g/mol. Its IUPAC name is 5-amino-2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid.
| Compound Name | 5-amino-2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114046976 |
| Molecular Formula | C13H12ClN3O2 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 5-amino-2-(3-chloro-2-methylanilino)pyridine-3-carboxylic acid |
| SMILES | Cc1c(Cl)cccc1Nc1ncc(N)cc1C(=O)O |
| InChI | InChI=1S/C13H12ClN3O2/c1-7-10(14)3-2-4-11(7)17-12-9(13(18)19)5-8(15)6-16-12/h2-6H,15H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | OLORGOPAURKGMZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |