C14H13ClN2O4 — CID 67072116
3-[(3-chloro-2-pyridinyl)amino]-2-(methoxymethoxy)benzoic acid (PubChem CID 67072116) has the molecular formula C14H13ClN2O4 and a molecular weight of 308.72 g/mol. Its IUPAC name is 3-[(3-chloro-2-pyridinyl)amino]-2-(methoxymethoxy)benzoic acid.
| Compound Name | 3-[(3-chloro-2-pyridinyl)amino]-2-(methoxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 67072116 |
| Molecular Formula | C14H13ClN2O4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 3-[(3-chloro-2-pyridinyl)amino]-2-(methoxymethoxy)benzoic acid |
| SMILES | COCOc1c(Nc2ncccc2Cl)cccc1C(=O)O |
| InChI | InChI=1S/C14H13ClN2O4/c1-20-8-21-12-9(14(18)19)4-2-6-11(12)17-13-10(15)5-3-7-16-13/h2-7H,8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | APWXUKWSLPTNFU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|