C9H11ClN2O2 — CID 75448204
N-(3-chloro-2-pyridinyl)-3-methoxypropanamide (PubChem CID 75448204) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is N-(3-chloro-2-pyridinyl)-3-methoxypropanamide.
| Compound Name | N-(3-chloro-2-pyridinyl)-3-methoxypropanamide |
|---|---|
| PubChem CID | 75448204 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | N-(3-chloro-2-pyridinyl)-3-methoxypropanamide |
| SMILES | COCCC(=O)Nc1ncccc1Cl |
| InChI | InChI=1S/C9H11ClN2O2/c1-14-6-4-8(13)12-9-7(10)3-2-5-11-9/h2-3,5H,4,6H2,1H3,(H,11,12,13) |
| InChIKey | QYDBNFUOTBCYGT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |