C9H10ClN3O2S — CID 154638035
ethyl N-[(3-chloro-2-pyridinyl)carbamothioyl]carbamate (PubChem CID 154638035) has the molecular formula C9H10ClN3O2S and a molecular weight of 259.72 g/mol. Its IUPAC name is ethyl N-[(3-chloro-2-pyridinyl)carbamothioyl]carbamate.
| Compound Name | ethyl N-[(3-chloro-2-pyridinyl)carbamothioyl]carbamate |
|---|---|
| PubChem CID | 154638035 |
| Molecular Formula | C9H10ClN3O2S |
| Molecular Weight | 259.72 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | ethyl N-[(3-chloro-2-pyridinyl)carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)Nc1ncccc1Cl |
| InChI | InChI=1S/C9H10ClN3O2S/c1-2-15-9(14)13-8(16)12-7-6(10)4-3-5-11-7/h3-5H,2H2,1H3,(H2,11,12,13,14,16) |
| InChIKey | SCUFTRFJVKQRKC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.72 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|