C12H15N3O5S — CID 121002980
methyl 2-(ethoxycarbonylcarbamothioylamino)-6-methoxypyridine-3-carboxylate (PubChem CID 121002980) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is methyl 2-(ethoxycarbonylcarbamothioylamino)-6-methoxypyridine-3-carboxylate.
| Compound Name | methyl 2-(ethoxycarbonylcarbamothioylamino)-6-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 121002980 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | methyl 2-(ethoxycarbonylcarbamothioylamino)-6-methoxypyridine-3-carboxylate |
| SMILES | CCOC(=O)NC(=S)Nc1nc(OC)ccc1C(=O)OC |
| InChI | InChI=1S/C12H15N3O5S/c1-4-20-12(17)15-11(21)14-9-7(10(16)19-3)5-6-8(13-9)18-2/h5-6H,4H2,1-3H3,(H2,13,14,15,17,21) |
| InChIKey | WLUKLIKXUBSHPN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|