C11H12BrN3O4S — CID 138491332
methyl 5-bromo-6-(ethoxycarbonylcarbamothioylamino)pyridine-3-carboxylate (PubChem CID 138491332) has the molecular formula C11H12BrN3O4S and a molecular weight of 362.21 g/mol. Its IUPAC name is methyl 5-bromo-6-(ethoxycarbonylcarbamothioylamino)pyridine-3-carboxylate.
| Compound Name | methyl 5-bromo-6-(ethoxycarbonylcarbamothioylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 138491332 |
| Molecular Formula | C11H12BrN3O4S |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | methyl 5-bromo-6-(ethoxycarbonylcarbamothioylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)NC(=S)Nc1ncc(C(=O)OC)cc1Br |
| InChI | InChI=1S/C11H12BrN3O4S/c1-3-19-11(17)15-10(20)14-8-7(12)4-6(5-13-8)9(16)18-2/h4-5H,3H2,1-2H3,(H2,13,14,15,17,20) |
| InChIKey | UOTJJMDHSAASQR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|