C15H19N5O6S2 — CID 170550034
methyl 6-[ethoxycarbonylcarbamothioyl-(ethoxycarbonylcarbamothioylamino)amino]pyridine-3-carboxylate (PubChem CID 170550034) has the molecular formula C15H19N5O6S2 and a molecular weight of 429.48 g/mol. Its IUPAC name is methyl 6-[ethoxycarbonylcarbamothioyl-(ethoxycarbonylcarbamothioylamino)amino]pyridine-3-carboxylate.
| Compound Name | methyl 6-[ethoxycarbonylcarbamothioyl-(ethoxycarbonylcarbamothioylamino)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170550034 |
| Molecular Formula | C15H19N5O6S2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | methyl 6-[ethoxycarbonylcarbamothioyl-(ethoxycarbonylcarbamothioylamino)amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)NC(=S)NN(C(=S)NC(=O)OCC)c1ccc(C(=O)OC)cn1 |
| InChI | InChI=1S/C15H19N5O6S2/c1-4-25-14(22)17-12(27)19-20(13(28)18-15(23)26-5-2)10-7-6-9(8-16-10)11(21)24-3/h6-8H,4-5H2,1-3H3,(H,18,23,28)(H2,17,19,22,27) |
| InChIKey | SKNSZUZYCMPGLI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|