C13H15NO6 — CID 7965360
methyl 4-[2-(ethoxycarbonylamino)-2-oxoethoxy]benzoate (PubChem CID 7965360) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is methyl 4-[2-(ethoxycarbonylamino)-2-oxoethoxy]benzoate.
| Compound Name | methyl 4-[2-(ethoxycarbonylamino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 7965360 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | methyl 4-[2-(ethoxycarbonylamino)-2-oxoethoxy]benzoate |
| SMILES | CCOC(=O)NC(=O)COc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C13H15NO6/c1-3-19-13(17)14-11(15)8-20-10-6-4-9(5-7-10)12(16)18-2/h4-7H,3,8H2,1-2H3,(H,14,15,17) |
| InChIKey | MIQGCFOCFBBWJG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |